C20H18O4 — CID 10496062
2-[6-methyl-2-(4-methylphenyl)-4-oxochromen-8-yl]propanoic acid (PubChem CID 10496062) has the molecular formula C20H18O4 and a molecular weight of 322.36 g/mol. Its IUPAC name is 2-[6-methyl-2-(4-methylphenyl)-4-oxochromen-8-yl]propanoic acid.
| Compound Name | 2-[6-methyl-2-(4-methylphenyl)-4-oxochromen-8-yl]propanoic acid |
|---|---|
| PubChem CID | 10496062 |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 2-[6-methyl-2-(4-methylphenyl)-4-oxochromen-8-yl]propanoic acid |
| SMILES | Cc1ccc(-c2cc(=O)c3cc(C)cc(C(C)C(=O)O)c3o2)cc1 |
| InChI | InChI=1S/C20H18O4/c1-11-4-6-14(7-5-11)18-10-17(21)16-9-12(2)8-15(19(16)24-18)13(3)20(22)23/h4-10,13H,1-3H3,(H,22,23) |
| InChIKey | SBYQVVWOOFTDRZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |