C24H19ClN2O4 — CID 166111289
6-chloro-3-[[(1R)-1-(6-methyl-4-oxo-2-phenylchromen-8-yl)ethyl]amino]pyridine-2-carboxylic acid (PubChem CID 166111289) has the molecular formula C24H19ClN2O4 and a molecular weight of 434.88 g/mol. Its IUPAC name is 6-chloro-3-[[(1R)-1-(6-methyl-4-oxo-2-phenylchromen-8-yl)ethyl]amino]pyridine-2-carboxylic acid.
| Compound Name | 6-chloro-3-[[(1R)-1-(6-methyl-4-oxo-2-phenylchromen-8-yl)ethyl]amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 166111289 |
| Molecular Formula | C24H19ClN2O4 |
| Molecular Weight | 434.88 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 6-chloro-3-[[(1R)-1-(6-methyl-4-oxo-2-phenylchromen-8-yl)ethyl]amino]pyridine-2-carboxylic acid |
| SMILES | Cc1cc([C@@H](C)Nc2ccc(Cl)nc2C(=O)O)c2oc(-c3ccccc3)cc(=O)c2c1 |
| InChI | InChI=1S/C24H19ClN2O4/c1-13-10-16(14(2)26-18-8-9-21(25)27-22(18)24(29)30)23-17(11-13)19(28)12-20(31-23)15-6-4-3-5-7-15/h3-12,14,26H,1-2H3,(H,29,30)/t14-/m1/s1 |
| InChIKey | SWXHUFYLGPLVCN-CQSZACIVSA-N |
| XLogP | 5.69 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.88 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|