C24H26ClN3O4 — CID 156876285
6-chloro-3-[1-(3,6-dimethyl-4-oxo-2-piperidin-1-ylchromen-8-yl)ethylamino]pyridine-2-carboxylic acid (PubChem CID 156876285) has the molecular formula C24H26ClN3O4 and a molecular weight of 455.94 g/mol. Its IUPAC name is 6-chloro-3-[1-(3,6-dimethyl-4-oxo-2-piperidin-1-ylchromen-8-yl)ethylamino]pyridine-2-carboxylic acid.
| Compound Name | 6-chloro-3-[1-(3,6-dimethyl-4-oxo-2-piperidin-1-ylchromen-8-yl)ethylamino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 156876285 |
| Molecular Formula | C24H26ClN3O4 |
| Molecular Weight | 455.94 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 6-chloro-3-[1-(3,6-dimethyl-4-oxo-2-piperidin-1-ylchromen-8-yl)ethylamino]pyridine-2-carboxylic acid |
| SMILES | Cc1cc(C(C)Nc2ccc(Cl)nc2C(=O)O)c2oc(N3CCCCC3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C24H26ClN3O4/c1-13-11-16(15(3)26-18-7-8-19(25)27-20(18)24(30)31)22-17(12-13)21(29)14(2)23(32-22)28-9-5-4-6-10-28/h7-8,11-12,15,26H,4-6,9-10H2,1-3H3,(H,30,31) |
| InChIKey | JDBYUIJSHHXGKV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.94 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|