C27H23ClN4O4 — CID 166147331
6-chloro-3-[1-[3,6-dimethyl-2-(2-methylindazol-5-yl)-4-oxochromen-8-yl]ethylamino]pyridine-2-carboxylic acid (PubChem CID 166147331) has the molecular formula C27H23ClN4O4 and a molecular weight of 502.96 g/mol. Its IUPAC name is 6-chloro-3-[1-[3,6-dimethyl-2-(2-methylindazol-5-yl)-4-oxochromen-8-yl]ethylamino]pyridine-2-carboxylic acid.
| Compound Name | 6-chloro-3-[1-[3,6-dimethyl-2-(2-methylindazol-5-yl)-4-oxochromen-8-yl]ethylamino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 166147331 |
| Molecular Formula | C27H23ClN4O4 |
| Molecular Weight | 502.96 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | 6-chloro-3-[1-[3,6-dimethyl-2-(2-methylindazol-5-yl)-4-oxochromen-8-yl]ethylamino]pyridine-2-carboxylic acid |
| SMILES | Cc1cc(C(C)Nc2ccc(Cl)nc2C(=O)O)c2oc(-c3ccc4nn(C)cc4c3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C27H23ClN4O4/c1-13-9-18(15(3)29-21-7-8-22(28)30-23(21)27(34)35)26-19(10-13)24(33)14(2)25(36-26)16-5-6-20-17(11-16)12-32(4)31-20/h5-12,15,29H,1-4H3,(H,34,35) |
| InChIKey | LKFVAFCWCDXUHY-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.96 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|