C25H22ClN3O4 — CID 169269774
6-chloro-3-[1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethylamino]-N-hydroxypyridine-2-carboxamide (PubChem CID 169269774) has the molecular formula C25H22ClN3O4 and a molecular weight of 463.92 g/mol. Its IUPAC name is 6-chloro-3-[1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethylamino]-N-hydroxypyridine-2-carboxamide.
| Compound Name | 6-chloro-3-[1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethylamino]-N-hydroxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 169269774 |
| Molecular Formula | C25H22ClN3O4 |
| Molecular Weight | 463.92 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | 6-chloro-3-[1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethylamino]-N-hydroxypyridine-2-carboxamide |
| SMILES | Cc1cc(C(C)Nc2ccc(Cl)nc2C(=O)NO)c2oc(-c3ccccc3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C25H22ClN3O4/c1-13-11-17(15(3)27-19-9-10-20(26)28-21(19)25(31)29-32)24-18(12-13)22(30)14(2)23(33-24)16-7-5-4-6-8-16/h4-12,15,27,32H,1-3H3,(H,29,31) |
| InChIKey | UWBNMKKVBTUGPS-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.92 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|