C26H24ClN3O5S — CID 169269012
6-chloro-3-[1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethylamino]-N-methylsulfonylpyridine-2-carboxamide (PubChem CID 169269012) has the molecular formula C26H24ClN3O5S and a molecular weight of 526.01 g/mol. Its IUPAC name is 6-chloro-3-[1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethylamino]-N-methylsulfonylpyridine-2-carboxamide.
| Compound Name | 6-chloro-3-[1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethylamino]-N-methylsulfonylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 169269012 |
| Molecular Formula | C26H24ClN3O5S |
| Molecular Weight | 526.01 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | 6-chloro-3-[1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethylamino]-N-methylsulfonylpyridine-2-carboxamide |
| SMILES | Cc1cc(C(C)Nc2ccc(Cl)nc2C(=O)NS(C)(=O)=O)c2oc(-c3ccccc3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C26H24ClN3O5S/c1-14-12-18(16(3)28-20-10-11-21(27)29-22(20)26(32)30-36(4,33)34)25-19(13-14)23(31)15(2)24(35-25)17-8-6-5-7-9-17/h5-13,16,28H,1-4H3,(H,30,32) |
| InChIKey | PFZQRBOVTRCEBX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.01 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|