C26H21ClN4O5S — CID 169268780
6-chloro-3-[1-(3-cyano-6-methyl-4-oxo-2-phenylchromen-8-yl)ethylamino]-N-methylsulfonylpyridine-2-carboxamide (PubChem CID 169268780) has the molecular formula C26H21ClN4O5S and a molecular weight of 537.00 g/mol. Its IUPAC name is 6-chloro-3-[1-(3-cyano-6-methyl-4-oxo-2-phenylchromen-8-yl)ethylamino]-N-methylsulfonylpyridine-2-carboxamide.
| Compound Name | 6-chloro-3-[1-(3-cyano-6-methyl-4-oxo-2-phenylchromen-8-yl)ethylamino]-N-methylsulfonylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 169268780 |
| Molecular Formula | C26H21ClN4O5S |
| Molecular Weight | 537.00 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | 6-chloro-3-[1-(3-cyano-6-methyl-4-oxo-2-phenylchromen-8-yl)ethylamino]-N-methylsulfonylpyridine-2-carboxamide |
| SMILES | Cc1cc(C(C)Nc2ccc(Cl)nc2C(=O)NS(C)(=O)=O)c2oc(-c3ccccc3)c(C#N)c(=O)c2c1 |
| InChI | InChI=1S/C26H21ClN4O5S/c1-14-11-17(15(2)29-20-9-10-21(27)30-22(20)26(33)31-37(3,34)35)25-18(12-14)23(32)19(13-28)24(36-25)16-7-5-4-6-8-16/h4-12,15,29H,1-3H3,(H,31,33) |
| InChIKey | MFWFCOOACHRUAG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 142.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.00 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|