C24H21ClN4O3 — CID 169269389
6-chloro-3-[[(1R)-1-(3,6-dimethyl-4-oxo-2-pyridin-3-ylchromen-8-yl)ethyl]amino]pyridine-2-carboxamide (PubChem CID 169269389) has the molecular formula C24H21ClN4O3 and a molecular weight of 448.91 g/mol. Its IUPAC name is 6-chloro-3-[[(1R)-1-(3,6-dimethyl-4-oxo-2-pyridin-3-ylchromen-8-yl)ethyl]amino]pyridine-2-carboxamide.
| Compound Name | 6-chloro-3-[[(1R)-1-(3,6-dimethyl-4-oxo-2-pyridin-3-ylchromen-8-yl)ethyl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 169269389 |
| Molecular Formula | C24H21ClN4O3 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 6-chloro-3-[[(1R)-1-(3,6-dimethyl-4-oxo-2-pyridin-3-ylchromen-8-yl)ethyl]amino]pyridine-2-carboxamide |
| SMILES | Cc1cc([C@@H](C)Nc2ccc(Cl)nc2C(N)=O)c2oc(-c3cccnc3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C24H21ClN4O3/c1-12-9-16(14(3)28-18-6-7-19(25)29-20(18)24(26)31)23-17(10-12)21(30)13(2)22(32-23)15-5-4-8-27-11-15/h4-11,14,28H,1-3H3,(H2,26,31)/t14-/m1/s1 |
| InChIKey | OAALTFFZLAGHPB-CQSZACIVSA-N |
| XLogP | 4.79 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|