C24H22ClN3O2 — CID 169270702
8-[(1R)-1-[(6-chloro-2-methyl-3-pyridinyl)amino]ethyl]-3,6-dimethyl-2-pyridin-3-ylchromen-4-one (PubChem CID 169270702) has the molecular formula C24H22ClN3O2 and a molecular weight of 419.91 g/mol. Its IUPAC name is 8-[(1R)-1-[(6-chloro-2-methyl-3-pyridinyl)amino]ethyl]-3,6-dimethyl-2-pyridin-3-ylchromen-4-one.
| Compound Name | 8-[(1R)-1-[(6-chloro-2-methyl-3-pyridinyl)amino]ethyl]-3,6-dimethyl-2-pyridin-3-ylchromen-4-one |
|---|---|
| PubChem CID | 169270702 |
| Molecular Formula | C24H22ClN3O2 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 8-[(1R)-1-[(6-chloro-2-methyl-3-pyridinyl)amino]ethyl]-3,6-dimethyl-2-pyridin-3-ylchromen-4-one |
| SMILES | Cc1cc([C@@H](C)Nc2ccc(Cl)nc2C)c2oc(-c3cccnc3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C24H22ClN3O2/c1-13-10-18(15(3)27-20-7-8-21(25)28-16(20)4)24-19(11-13)22(29)14(2)23(30-24)17-6-5-9-26-12-17/h5-12,15,27H,1-4H3/t15-/m1/s1 |
| InChIKey | LMAAQRUYWRFXDX-OAHLLOKOSA-N |
| XLogP | 6.00 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|