C24H22ClN3O3 — CID 169269679
5-[8-[1-[(6-chloro-2-methyl-3-pyridinyl)amino]ethyl]-3,6-dimethyl-4-oxochromen-2-yl]-1H-pyridin-2-one (PubChem CID 169269679) has the molecular formula C24H22ClN3O3 and a molecular weight of 435.91 g/mol. Its IUPAC name is 5-[8-[1-[(6-chloro-2-methyl-3-pyridinyl)amino]ethyl]-3,6-dimethyl-4-oxochromen-2-yl]-1H-pyridin-2-one.
| Compound Name | 5-[8-[1-[(6-chloro-2-methyl-3-pyridinyl)amino]ethyl]-3,6-dimethyl-4-oxochromen-2-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 169269679 |
| Molecular Formula | C24H22ClN3O3 |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 5-[8-[1-[(6-chloro-2-methyl-3-pyridinyl)amino]ethyl]-3,6-dimethyl-4-oxochromen-2-yl]-1H-pyridin-2-one |
| SMILES | Cc1cc(C(C)Nc2ccc(Cl)nc2C)c2oc(-c3ccc(=O)[nH]c3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C24H22ClN3O3/c1-12-9-17(14(3)27-19-6-7-20(25)28-15(19)4)24-18(10-12)22(30)13(2)23(31-24)16-5-8-21(29)26-11-16/h5-11,14,27H,1-4H3,(H,26,29) |
| InChIKey | PFCJFXNHGZYMJK-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|