C27H23ClN2O2 — CID 174170919
8-[(1R)-1-[(6-chloro-2-methyl-3-pyridinyl)amino]ethyl]-2-(3-ethynylphenyl)-3,6-dimethylchromen-4-one (PubChem CID 174170919) has the molecular formula C27H23ClN2O2 and a molecular weight of 442.95 g/mol. Its IUPAC name is 8-[(1R)-1-[(6-chloro-2-methyl-3-pyridinyl)amino]ethyl]-2-(3-ethynylphenyl)-3,6-dimethylchromen-4-one.
| Compound Name | 8-[(1R)-1-[(6-chloro-2-methyl-3-pyridinyl)amino]ethyl]-2-(3-ethynylphenyl)-3,6-dimethylchromen-4-one |
|---|---|
| PubChem CID | 174170919 |
| Molecular Formula | C27H23ClN2O2 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 8-[(1R)-1-[(6-chloro-2-methyl-3-pyridinyl)amino]ethyl]-2-(3-ethynylphenyl)-3,6-dimethylchromen-4-one |
| SMILES | C#Cc1cccc(-c2oc3c([C@@H](C)Nc4ccc(Cl)nc4C)cc(C)cc3c(=O)c2C)c1 |
| InChI | InChI=1S/C27H23ClN2O2/c1-6-19-8-7-9-20(14-19)26-16(3)25(31)22-13-15(2)12-21(27(22)32-26)17(4)29-23-10-11-24(28)30-18(23)5/h1,7-14,17,29H,2-5H3/t17-/m1/s1 |
| InChIKey | OJVJYDNUKOTHPI-QGZVFWFLSA-N |
| XLogP | 6.59 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|