C26H22ClN3O2 — CID 169269488
3-[8-[1-[(6-chloro-2-methyl-3-pyridinyl)amino]ethyl]-3,6-dimethyl-4-oxochromen-2-yl]benzonitrile (PubChem CID 169269488) has the molecular formula C26H22ClN3O2 and a molecular weight of 443.93 g/mol. Its IUPAC name is 3-[8-[1-[(6-chloro-2-methyl-3-pyridinyl)amino]ethyl]-3,6-dimethyl-4-oxochromen-2-yl]benzonitrile.
| Compound Name | 3-[8-[1-[(6-chloro-2-methyl-3-pyridinyl)amino]ethyl]-3,6-dimethyl-4-oxochromen-2-yl]benzonitrile |
|---|---|
| PubChem CID | 169269488 |
| Molecular Formula | C26H22ClN3O2 |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 3-[8-[1-[(6-chloro-2-methyl-3-pyridinyl)amino]ethyl]-3,6-dimethyl-4-oxochromen-2-yl]benzonitrile |
| SMILES | Cc1cc(C(C)Nc2ccc(Cl)nc2C)c2oc(-c3cccc(C#N)c3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C26H22ClN3O2/c1-14-10-20(16(3)29-22-8-9-23(27)30-17(22)4)26-21(11-14)24(31)15(2)25(32-26)19-7-5-6-18(12-19)13-28/h5-12,16,29H,1-4H3 |
| InChIKey | UNCFXMUNHCWFEC-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|