C28H25ClN4O2 — CID 174170847
1-[6-chloro-3-[[(1R)-1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethyl]amino]-2-pyridinyl]azetidine-3-carbonitrile (PubChem CID 174170847) has the molecular formula C28H25ClN4O2 and a molecular weight of 484.99 g/mol. Its IUPAC name is 1-[6-chloro-3-[[(1R)-1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethyl]amino]-2-pyridinyl]azetidine-3-carbonitrile.
| Compound Name | 1-[6-chloro-3-[[(1R)-1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethyl]amino]-2-pyridinyl]azetidine-3-carbonitrile |
|---|---|
| PubChem CID | 174170847 |
| Molecular Formula | C28H25ClN4O2 |
| Molecular Weight | 484.99 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 1-[6-chloro-3-[[(1R)-1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethyl]amino]-2-pyridinyl]azetidine-3-carbonitrile |
| SMILES | Cc1cc([C@@H](C)Nc2ccc(Cl)nc2N2CC(C#N)C2)c2oc(-c3ccccc3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C28H25ClN4O2/c1-16-11-21(18(3)31-23-9-10-24(29)32-28(23)33-14-19(13-30)15-33)27-22(12-16)25(34)17(2)26(35-27)20-7-5-4-6-8-20/h4-12,18-19,31H,14-15H2,1-3H3/t18-/m1/s1 |
| InChIKey | UNYXHQIJSTVOKZ-GOSISDBHSA-N |
| XLogP | 6.26 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.99 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|