C25H22BrNO2 — CID 169269250
8-[1-(2-bromoanilino)ethyl]-3,6-dimethyl-2-phenylchromen-4-one (PubChem CID 169269250) has the molecular formula C25H22BrNO2 and a molecular weight of 448.36 g/mol. Its IUPAC name is 8-[1-(2-bromoanilino)ethyl]-3,6-dimethyl-2-phenylchromen-4-one.
| Compound Name | 8-[1-(2-bromoanilino)ethyl]-3,6-dimethyl-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 169269250 |
| Molecular Formula | C25H22BrNO2 |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 8-[1-(2-bromoanilino)ethyl]-3,6-dimethyl-2-phenylchromen-4-one |
| SMILES | Cc1cc(C(C)Nc2ccccc2Br)c2oc(-c3ccccc3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C25H22BrNO2/c1-15-13-19(17(3)27-22-12-8-7-11-21(22)26)25-20(14-15)23(28)16(2)24(29-25)18-9-5-4-6-10-18/h4-14,17,27H,1-3H3 |
| InChIKey | REQXQYOJSXBFPK-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |