C30H31NO2Si — CID 169269046
3,6-dimethyl-2-phenyl-8-[(1R)-1-[2-(2-trimethylsilylethynyl)anilino]ethyl]chromen-4-one (PubChem CID 169269046) has the molecular formula C30H31NO2Si and a molecular weight of 465.67 g/mol. Its IUPAC name is 3,6-dimethyl-2-phenyl-8-[(1R)-1-[2-(2-trimethylsilylethynyl)anilino]ethyl]chromen-4-one.
| Compound Name | 3,6-dimethyl-2-phenyl-8-[(1R)-1-[2-(2-trimethylsilylethynyl)anilino]ethyl]chromen-4-one |
|---|---|
| PubChem CID | 169269046 |
| Molecular Formula | C30H31NO2Si |
| Molecular Weight | 465.67 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 3,6-dimethyl-2-phenyl-8-[(1R)-1-[2-(2-trimethylsilylethynyl)anilino]ethyl]chromen-4-one |
| SMILES | Cc1cc([C@@H](C)Nc2ccccc2C#C[Si](C)(C)C)c2oc(-c3ccccc3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C30H31NO2Si/c1-20-18-25(22(3)31-27-15-11-10-12-23(27)16-17-34(4,5)6)30-26(19-20)28(32)21(2)29(33-30)24-13-8-7-9-14-24/h7-15,18-19,22,31H,1-6H3/t22-/m1/s1 |
| InChIKey | GIOIVSCRGKRBQP-JOCHJYFZSA-N |
| XLogP | 7.48 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.67 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|