C27H28NO5P — CID 169270405
8-[(1R)-1-(2-dimethoxyphosphorylanilino)ethyl]-3,6-dimethyl-2-phenylchromen-4-one (PubChem CID 169270405) has the molecular formula C27H28NO5P and a molecular weight of 477.50 g/mol. Its IUPAC name is 8-[(1R)-1-(2-dimethoxyphosphorylanilino)ethyl]-3,6-dimethyl-2-phenylchromen-4-one.
| Compound Name | 8-[(1R)-1-(2-dimethoxyphosphorylanilino)ethyl]-3,6-dimethyl-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 169270405 |
| Molecular Formula | C27H28NO5P |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 8-[(1R)-1-(2-dimethoxyphosphorylanilino)ethyl]-3,6-dimethyl-2-phenylchromen-4-one |
| SMILES | COP(=O)(OC)c1ccccc1N[C@H](C)c1cc(C)cc2c(=O)c(C)c(-c3ccccc3)oc12 |
| InChI | InChI=1S/C27H28NO5P/c1-17-15-21(19(3)28-23-13-9-10-14-24(23)34(30,31-4)32-5)27-22(16-17)25(29)18(2)26(33-27)20-11-7-6-8-12-20/h6-16,19,28H,1-5H3/t19-/m1/s1 |
| InChIKey | YXUNYMYINFTIIQ-LJQANCHMSA-N |
| XLogP | 6.36 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|