C24H21FN2O2 — CID 169270678
8-[1-[(2-fluoro-3-pyridinyl)amino]ethyl]-3,6-dimethyl-2-phenylchromen-4-one (PubChem CID 169270678) has the molecular formula C24H21FN2O2 and a molecular weight of 388.44 g/mol. Its IUPAC name is 8-[1-[(2-fluoro-3-pyridinyl)amino]ethyl]-3,6-dimethyl-2-phenylchromen-4-one.
| Compound Name | 8-[1-[(2-fluoro-3-pyridinyl)amino]ethyl]-3,6-dimethyl-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 169270678 |
| Molecular Formula | C24H21FN2O2 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 8-[1-[(2-fluoro-3-pyridinyl)amino]ethyl]-3,6-dimethyl-2-phenylchromen-4-one |
| SMILES | Cc1cc(C(C)Nc2cccnc2F)c2oc(-c3ccccc3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C24H21FN2O2/c1-14-12-18(16(3)27-20-10-7-11-26-24(20)25)23-19(13-14)21(28)15(2)22(29-23)17-8-5-4-6-9-17/h4-13,16,27H,1-3H3 |
| InChIKey | LPWQIHHFCFFYSF-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|