C25H23ClN2O2 — CID 174170947
8-[(1R)-1-[(2-chloro-6-methyl-3-pyridinyl)amino]ethyl]-3,6-dimethyl-2-phenylchromen-4-one (PubChem CID 174170947) has the molecular formula C25H23ClN2O2 and a molecular weight of 418.92 g/mol. Its IUPAC name is 8-[(1R)-1-[(2-chloro-6-methyl-3-pyridinyl)amino]ethyl]-3,6-dimethyl-2-phenylchromen-4-one.
| Compound Name | 8-[(1R)-1-[(2-chloro-6-methyl-3-pyridinyl)amino]ethyl]-3,6-dimethyl-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 174170947 |
| Molecular Formula | C25H23ClN2O2 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 8-[(1R)-1-[(2-chloro-6-methyl-3-pyridinyl)amino]ethyl]-3,6-dimethyl-2-phenylchromen-4-one |
| SMILES | Cc1cc([C@@H](C)Nc2ccc(C)nc2Cl)c2oc(-c3ccccc3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C25H23ClN2O2/c1-14-12-19(17(4)28-21-11-10-15(2)27-25(21)26)24-20(13-14)22(29)16(3)23(30-24)18-8-6-5-7-9-18/h5-13,17,28H,1-4H3/t17-/m1/s1 |
| InChIKey | YIVCDBKXVBVMKM-QGZVFWFLSA-N |
| XLogP | 6.61 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|