C30H32ClN5O3 — CID 174206054
8-[1-[[6-chloro-2-[4-(oxetan-3-yl)piperazin-1-yl]-3-pyridinyl]amino]ethyl]-3,6-dimethyl-2-pyridin-3-ylchromen-4-one (PubChem CID 174206054) has the molecular formula C30H32ClN5O3 and a molecular weight of 546.07 g/mol. Its IUPAC name is 8-[1-[[6-chloro-2-[4-(oxetan-3-yl)piperazin-1-yl]-3-pyridinyl]amino]ethyl]-3,6-dimethyl-2-pyridin-3-ylchromen-4-one.
| Compound Name | 8-[1-[[6-chloro-2-[4-(oxetan-3-yl)piperazin-1-yl]-3-pyridinyl]amino]ethyl]-3,6-dimethyl-2-pyridin-3-ylchromen-4-one |
|---|---|
| PubChem CID | 174206054 |
| Molecular Formula | C30H32ClN5O3 |
| Molecular Weight | 546.07 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | 8-[1-[[6-chloro-2-[4-(oxetan-3-yl)piperazin-1-yl]-3-pyridinyl]amino]ethyl]-3,6-dimethyl-2-pyridin-3-ylchromen-4-one |
| SMILES | Cc1cc(C(C)Nc2ccc(Cl)nc2N2CCN(C3COC3)CC2)c2oc(-c3cccnc3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C30H32ClN5O3/c1-18-13-23(29-24(14-18)27(37)19(2)28(39-29)21-5-4-8-32-15-21)20(3)33-25-6-7-26(31)34-30(25)36-11-9-35(10-12-36)22-16-38-17-22/h4-8,13-15,20,22,33H,9-12,16-17H2,1-3H3 |
| InChIKey | ZEISNDOEFRNBMV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.07 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|