C27H27ClN4O3 — CID 169269139
8-[(1R)-1-[[6-chloro-2-(1,3-oxazinan-3-yl)-3-pyridinyl]amino]ethyl]-3,6-dimethyl-2-pyridin-3-ylchromen-4-one (PubChem CID 169269139) has the molecular formula C27H27ClN4O3 and a molecular weight of 490.99 g/mol. Its IUPAC name is 8-[(1R)-1-[[6-chloro-2-(1,3-oxazinan-3-yl)-3-pyridinyl]amino]ethyl]-3,6-dimethyl-2-pyridin-3-ylchromen-4-one.
| Compound Name | 8-[(1R)-1-[[6-chloro-2-(1,3-oxazinan-3-yl)-3-pyridinyl]amino]ethyl]-3,6-dimethyl-2-pyridin-3-ylchromen-4-one |
|---|---|
| PubChem CID | 169269139 |
| Molecular Formula | C27H27ClN4O3 |
| Molecular Weight | 490.99 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 8-[(1R)-1-[[6-chloro-2-(1,3-oxazinan-3-yl)-3-pyridinyl]amino]ethyl]-3,6-dimethyl-2-pyridin-3-ylchromen-4-one |
| SMILES | Cc1cc([C@@H](C)Nc2ccc(Cl)nc2N2CCCOC2)c2oc(-c3cccnc3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C27H27ClN4O3/c1-16-12-20(18(3)30-22-7-8-23(28)31-27(22)32-10-5-11-34-15-32)26-21(13-16)24(33)17(2)25(35-26)19-6-4-9-29-14-19/h4,6-9,12-14,18,30H,5,10-11,15H2,1-3H3/t18-/m1/s1 |
| InChIKey | NVNLSAYSZLSVSC-GOSISDBHSA-N |
| XLogP | 5.88 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.99 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|