C25H23ClN4O3 — CID 169268904
5-chloro-2-[[(1R)-1-(3,6-dimethyl-4-oxo-2-pyridin-3-ylchromen-8-yl)ethyl]amino]-N'-hydroxybenzenecarboximidamide (PubChem CID 169268904) has the molecular formula C25H23ClN4O3 and a molecular weight of 462.94 g/mol. Its IUPAC name is 5-chloro-2-[[(1R)-1-(3,6-dimethyl-4-oxo-2-pyridin-3-ylchromen-8-yl)ethyl]amino]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 5-chloro-2-[[(1R)-1-(3,6-dimethyl-4-oxo-2-pyridin-3-ylchromen-8-yl)ethyl]amino]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 169268904 |
| Molecular Formula | C25H23ClN4O3 |
| Molecular Weight | 462.94 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 5-chloro-2-[[(1R)-1-(3,6-dimethyl-4-oxo-2-pyridin-3-ylchromen-8-yl)ethyl]amino]-N'-hydroxybenzenecarboximidamide |
| SMILES | Cc1cc([C@@H](C)Nc2ccc(Cl)cc2/C(N)=N/O)c2oc(-c3cccnc3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C25H23ClN4O3/c1-13-9-18(15(3)29-21-7-6-17(26)11-19(21)25(27)30-32)24-20(10-13)22(31)14(2)23(33-24)16-5-4-8-28-12-16/h4-12,15,29,32H,1-3H3,(H2,27,30)/t15-/m1/s1 |
| InChIKey | XKOMFIDWNNGJOZ-OAHLLOKOSA-N |
| XLogP | 5.39 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.94 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|