C24H21ClFN5O3 — CID 169269724
6-chloro-3-[[(1R)-1-[2-(5-fluoro-3-pyridinyl)-3,6-dimethyl-4-oxochromen-8-yl]ethyl]amino]-N'-hydroxypyridine-2-carboximidamide (PubChem CID 169269724) has the molecular formula C24H21ClFN5O3 and a molecular weight of 481.92 g/mol. Its IUPAC name is 6-chloro-3-[[(1R)-1-[2-(5-fluoro-3-pyridinyl)-3,6-dimethyl-4-oxochromen-8-yl]ethyl]amino]-N'-hydroxypyridine-2-carboximidamide.
| Compound Name | 6-chloro-3-[[(1R)-1-[2-(5-fluoro-3-pyridinyl)-3,6-dimethyl-4-oxochromen-8-yl]ethyl]amino]-N'-hydroxypyridine-2-carboximidamide |
|---|---|
| PubChem CID | 169269724 |
| Molecular Formula | C24H21ClFN5O3 |
| Molecular Weight | 481.92 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 6-chloro-3-[[(1R)-1-[2-(5-fluoro-3-pyridinyl)-3,6-dimethyl-4-oxochromen-8-yl]ethyl]amino]-N'-hydroxypyridine-2-carboximidamide |
| SMILES | Cc1cc([C@@H](C)Nc2ccc(Cl)nc2/C(N)=N/O)c2oc(-c3cncc(F)c3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C24H21ClFN5O3/c1-11-6-16(13(3)29-18-4-5-19(25)30-20(18)24(27)31-33)23-17(7-11)21(32)12(2)22(34-23)14-8-15(26)10-28-9-14/h4-10,13,29,33H,1-3H3,(H2,27,31)/t13-/m1/s1 |
| InChIKey | GGAAIYIYIPIGFU-CYBMUJFWSA-N |
| XLogP | 4.93 |
| TPSA | 126.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.92 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|