C25H21ClF2N4O3 — CID 174166882
6-chloro-3-[[(1R)-1-[2-(2,6-difluorophenyl)-3,6-dimethyl-4-oxochromen-8-yl]ethyl]amino]-N'-hydroxypyridine-2-carboximidamide (PubChem CID 174166882) has the molecular formula C25H21ClF2N4O3 and a molecular weight of 498.92 g/mol. Its IUPAC name is 6-chloro-3-[[(1R)-1-[2-(2,6-difluorophenyl)-3,6-dimethyl-4-oxochromen-8-yl]ethyl]amino]-N'-hydroxypyridine-2-carboximidamide.
| Compound Name | 6-chloro-3-[[(1R)-1-[2-(2,6-difluorophenyl)-3,6-dimethyl-4-oxochromen-8-yl]ethyl]amino]-N'-hydroxypyridine-2-carboximidamide |
|---|---|
| PubChem CID | 174166882 |
| Molecular Formula | C25H21ClF2N4O3 |
| Molecular Weight | 498.92 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | 6-chloro-3-[[(1R)-1-[2-(2,6-difluorophenyl)-3,6-dimethyl-4-oxochromen-8-yl]ethyl]amino]-N'-hydroxypyridine-2-carboximidamide |
| SMILES | Cc1cc([C@@H](C)Nc2ccc(Cl)nc2C(N)=NO)c2oc(-c3c(F)cccc3F)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C25H21ClF2N4O3/c1-11-9-14(13(3)30-18-7-8-19(26)31-21(18)25(29)32-34)24-15(10-11)22(33)12(2)23(35-24)20-16(27)5-4-6-17(20)28/h4-10,13,30,34H,1-3H3,(H2,29,32)/t13-/m1/s1 |
| InChIKey | RMJRWWMWDLJYBW-CYBMUJFWSA-N |
| XLogP | 5.67 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.92 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|