C27H21ClFN3O3 — CID 174170806
6-chloro-3-[[(1R)-1-[2-(3-ethynyl-2-fluorophenyl)-3,6-dimethyl-4-oxochromen-8-yl]ethyl]amino]pyridine-2-carboxamide (PubChem CID 174170806) has the molecular formula C27H21ClFN3O3 and a molecular weight of 489.93 g/mol. Its IUPAC name is 6-chloro-3-[[(1R)-1-[2-(3-ethynyl-2-fluorophenyl)-3,6-dimethyl-4-oxochromen-8-yl]ethyl]amino]pyridine-2-carboxamide.
| Compound Name | 6-chloro-3-[[(1R)-1-[2-(3-ethynyl-2-fluorophenyl)-3,6-dimethyl-4-oxochromen-8-yl]ethyl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 174170806 |
| Molecular Formula | C27H21ClFN3O3 |
| Molecular Weight | 489.93 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | 6-chloro-3-[[(1R)-1-[2-(3-ethynyl-2-fluorophenyl)-3,6-dimethyl-4-oxochromen-8-yl]ethyl]amino]pyridine-2-carboxamide |
| SMILES | C#Cc1cccc(-c2oc3c([C@@H](C)Nc4ccc(Cl)nc4C(N)=O)cc(C)cc3c(=O)c2C)c1F |
| InChI | InChI=1S/C27H21ClFN3O3/c1-5-16-7-6-8-17(22(16)29)25-14(3)24(33)19-12-13(2)11-18(26(19)35-25)15(4)31-20-9-10-21(28)32-23(20)27(30)34/h1,6-12,15,31H,2-4H3,(H2,30,34)/t15-/m1/s1 |
| InChIKey | UJLPVMMCJDVMBV-OAHLLOKOSA-N |
| XLogP | 5.52 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.93 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|