C23H24ClN5O3 — CID 169269766
3-[1-[2-[(E)-1-amino-3-methyliminoprop-1-en-2-yl]-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-6-chloropyridine-2-carboxamide (PubChem CID 169269766) has the molecular formula C23H24ClN5O3 and a molecular weight of 453.93 g/mol. Its IUPAC name is 3-[1-[2-[(E)-1-amino-3-methyliminoprop-1-en-2-yl]-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-6-chloropyridine-2-carboxamide.
| Compound Name | 3-[1-[2-[(E)-1-amino-3-methyliminoprop-1-en-2-yl]-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-6-chloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 169269766 |
| Molecular Formula | C23H24ClN5O3 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 3-[1-[2-[(E)-1-amino-3-methyliminoprop-1-en-2-yl]-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-6-chloropyridine-2-carboxamide |
| SMILES | C/N=C/C(=C\N)c1oc2c(C(C)Nc3ccc(Cl)nc3C(N)=O)cc(C)cc2c(=O)c1C |
| InChI | InChI=1S/C23H24ClN5O3/c1-11-7-15(13(3)28-17-5-6-18(24)29-19(17)23(26)31)22-16(8-11)20(30)12(2)21(32-22)14(9-25)10-27-4/h5-10,13,28H,25H2,1-4H3,(H2,26,31)/b14-9+,27-10+ |
| InChIKey | YJBFTAQSFGSMRX-GEBBHNTESA-N |
| XLogP | 3.73 |
| TPSA | 136.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|