C26H27ClN6O5 — CID 169269703
3-[3-[1-[2-[(E)-1-amino-3-(2-methoxyethylimino)prop-1-en-2-yl]-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-6-chloro-2-pyridinyl]-4H-1,2,4-oxadiazol-5-one (PubChem CID 169269703) has the molecular formula C26H27ClN6O5 and a molecular weight of 538.99 g/mol. Its IUPAC name is 3-[3-[1-[2-[(E)-1-amino-3-(2-methoxyethylimino)prop-1-en-2-yl]-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-6-chloro-2-pyridinyl]-4H-1,2,4-oxadiazol-5-one.
| Compound Name | 3-[3-[1-[2-[(E)-1-amino-3-(2-methoxyethylimino)prop-1-en-2-yl]-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-6-chloro-2-pyridinyl]-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 169269703 |
| Molecular Formula | C26H27ClN6O5 |
| Molecular Weight | 538.99 g/mol |
| Exact Mass | 538.17 |
| IUPAC Name | 3-[3-[1-[2-[(E)-1-amino-3-(2-methoxyethylimino)prop-1-en-2-yl]-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-6-chloro-2-pyridinyl]-4H-1,2,4-oxadiazol-5-one |
| SMILES | COCC/N=C/C(=C\N)c1oc2c(C(C)Nc3ccc(Cl)nc3-c3noc(=O)[nH]3)cc(C)cc2c(=O)c1C |
| InChI | InChI=1S/C26H27ClN6O5/c1-13-9-17(15(3)30-19-5-6-20(27)31-21(19)25-32-26(35)38-33-25)24-18(10-13)22(34)14(2)23(37-24)16(11-28)12-29-7-8-36-4/h5-6,9-12,15,30H,7-8,28H2,1-4H3,(H,32,33,35)/b16-11+,29-12+ |
| InChIKey | IZBMJUZURAJERQ-DVMIHZDRSA-N |
| XLogP | 3.99 |
| TPSA | 161.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.99 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|