C26H31ClN6O4 — CID 169270491
3-[1-[2-[(E)-1-amino-3-(2-hydroxy-2-methylpropyl)iminoprop-1-en-2-yl]-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-6-chloro-N'-hydroxypyridine-2-carboximidamide (PubChem CID 169270491) has the molecular formula C26H31ClN6O4 and a molecular weight of 527.03 g/mol. Its IUPAC name is 3-[1-[2-[(E)-1-amino-3-(2-hydroxy-2-methylpropyl)iminoprop-1-en-2-yl]-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-6-chloro-N'-hydroxypyridine-2-carboximidamide.
| Compound Name | 3-[1-[2-[(E)-1-amino-3-(2-hydroxy-2-methylpropyl)iminoprop-1-en-2-yl]-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-6-chloro-N'-hydroxypyridine-2-carboximidamide |
|---|---|
| PubChem CID | 169270491 |
| Molecular Formula | C26H31ClN6O4 |
| Molecular Weight | 527.03 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | 3-[1-[2-[(E)-1-amino-3-(2-hydroxy-2-methylpropyl)iminoprop-1-en-2-yl]-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-6-chloro-N'-hydroxypyridine-2-carboximidamide |
| SMILES | Cc1cc(C(C)Nc2ccc(Cl)nc2/C(N)=N/O)c2oc(C(/C=N/CC(C)(C)O)=C/N)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C26H31ClN6O4/c1-13-8-17(15(3)31-19-6-7-20(27)32-21(19)25(29)33-36)24-18(9-13)22(34)14(2)23(37-24)16(10-28)11-30-12-26(4,5)35/h6-11,15,31,35-36H,12,28H2,1-5H3,(H2,29,33)/b16-10+,30-11+ |
| InChIKey | CKUJKNJRIGUHKR-ATCGKWFMSA-N |
| XLogP | 3.87 |
| TPSA | 172.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.03 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|