C28H33ClN4O4 — CID 169269803
tert-butyl 3-[1-[2-[(E)-3-amino-1-methyliminobut-2-en-2-yl]-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-6-chloropyridine-2-carboxylate (PubChem CID 169269803) has the molecular formula C28H33ClN4O4 and a molecular weight of 525.05 g/mol. Its IUPAC name is tert-butyl 3-[1-[2-[(E)-3-amino-1-methyliminobut-2-en-2-yl]-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-6-chloropyridine-2-carboxylate.
| Compound Name | tert-butyl 3-[1-[2-[(E)-3-amino-1-methyliminobut-2-en-2-yl]-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-6-chloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 169269803 |
| Molecular Formula | C28H33ClN4O4 |
| Molecular Weight | 525.05 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | tert-butyl 3-[1-[2-[(E)-3-amino-1-methyliminobut-2-en-2-yl]-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-6-chloropyridine-2-carboxylate |
| SMILES | C/N=C/C(=C(/C)N)c1oc2c(C(C)Nc3ccc(Cl)nc3C(=O)OC(C)(C)C)cc(C)cc2c(=O)c1C |
| InChI | InChI=1S/C28H33ClN4O4/c1-14-11-18(17(4)32-21-9-10-22(29)33-23(21)27(35)37-28(5,6)7)26-19(12-14)24(34)15(2)25(36-26)20(13-31-8)16(3)30/h9-13,17,32H,30H2,1-8H3/b20-16+,31-13+ |
| InChIKey | NJFFSLBXFGZIGT-LRNMGUBSSA-N |
| XLogP | 5.98 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.05 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|