C30H31ClN4O4 — CID 166147067
tert-butyl 3-[1-[2-[4-amino-3-(methyliminomethyl)phenyl]-6-methyl-4-oxochromen-8-yl]ethylamino]-6-chloropyridine-2-carboxylate (PubChem CID 166147067) has the molecular formula C30H31ClN4O4 and a molecular weight of 547.06 g/mol. Its IUPAC name is tert-butyl 3-[1-[2-[4-amino-3-(methyliminomethyl)phenyl]-6-methyl-4-oxochromen-8-yl]ethylamino]-6-chloropyridine-2-carboxylate.
| Compound Name | tert-butyl 3-[1-[2-[4-amino-3-(methyliminomethyl)phenyl]-6-methyl-4-oxochromen-8-yl]ethylamino]-6-chloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 166147067 |
| Molecular Formula | C30H31ClN4O4 |
| Molecular Weight | 547.06 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | tert-butyl 3-[1-[2-[4-amino-3-(methyliminomethyl)phenyl]-6-methyl-4-oxochromen-8-yl]ethylamino]-6-chloropyridine-2-carboxylate |
| SMILES | C/N=C/c1cc(-c2cc(=O)c3cc(C)cc(C(C)Nc4ccc(Cl)nc4C(=O)OC(C)(C)C)c3o2)ccc1N |
| InChI | InChI=1S/C30H31ClN4O4/c1-16-11-20(17(2)34-23-9-10-26(31)35-27(23)29(37)39-30(3,4)5)28-21(12-16)24(36)14-25(38-28)18-7-8-22(32)19(13-18)15-33-6/h7-15,17,34H,32H2,1-6H3/b33-15+ |
| InChIKey | XDPRTMXPYSOKOL-ROPCREHHSA-N |
| XLogP | 6.58 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.06 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|