C27H24ClF3N4O2 — CID 169268917
2-[4-amino-3-(methyliminomethyl)phenyl]-8-[1-[[6-chloro-2-(trifluoromethyl)-3-pyridinyl]amino]ethyl]-3,6-dimethylchromen-4-one (PubChem CID 169268917) has the molecular formula C27H24ClF3N4O2 and a molecular weight of 528.96 g/mol. Its IUPAC name is 2-[4-amino-3-(methyliminomethyl)phenyl]-8-[1-[[6-chloro-2-(trifluoromethyl)-3-pyridinyl]amino]ethyl]-3,6-dimethylchromen-4-one.
| Compound Name | 2-[4-amino-3-(methyliminomethyl)phenyl]-8-[1-[[6-chloro-2-(trifluoromethyl)-3-pyridinyl]amino]ethyl]-3,6-dimethylchromen-4-one |
|---|---|
| PubChem CID | 169268917 |
| Molecular Formula | C27H24ClF3N4O2 |
| Molecular Weight | 528.96 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | 2-[4-amino-3-(methyliminomethyl)phenyl]-8-[1-[[6-chloro-2-(trifluoromethyl)-3-pyridinyl]amino]ethyl]-3,6-dimethylchromen-4-one |
| SMILES | C/N=C/c1cc(-c2oc3c(C(C)Nc4ccc(Cl)nc4C(F)(F)F)cc(C)cc3c(=O)c2C)ccc1N |
| InChI | InChI=1S/C27H24ClF3N4O2/c1-13-9-18(15(3)34-21-7-8-22(28)35-26(21)27(29,30)31)25-19(10-13)23(36)14(2)24(37-25)16-5-6-20(32)17(11-16)12-33-4/h5-12,15,34H,32H2,1-4H3/b33-12+ |
| InChIKey | WYLQPZTVAWOAHA-RVDKCFQWSA-N |
| XLogP | 6.95 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.96 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|