C28H26FN3O4 — CID 166146992
2-[[(1R)-1-[2-[4-amino-3-(methyliminomethyl)phenyl]-3,6-dimethyl-4-oxochromen-8-yl]ethyl]amino]-6-fluorobenzoic acid (PubChem CID 166146992) has the molecular formula C28H26FN3O4 and a molecular weight of 487.53 g/mol. Its IUPAC name is 2-[[(1R)-1-[2-[4-amino-3-(methyliminomethyl)phenyl]-3,6-dimethyl-4-oxochromen-8-yl]ethyl]amino]-6-fluorobenzoic acid.
| Compound Name | 2-[[(1R)-1-[2-[4-amino-3-(methyliminomethyl)phenyl]-3,6-dimethyl-4-oxochromen-8-yl]ethyl]amino]-6-fluorobenzoic acid |
|---|---|
| PubChem CID | 166146992 |
| Molecular Formula | C28H26FN3O4 |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 2-[[(1R)-1-[2-[4-amino-3-(methyliminomethyl)phenyl]-3,6-dimethyl-4-oxochromen-8-yl]ethyl]amino]-6-fluorobenzoic acid |
| SMILES | C/N=C/c1cc(-c2oc3c([C@@H](C)Nc4cccc(F)c4C(=O)O)cc(C)cc3c(=O)c2C)ccc1N |
| InChI | InChI=1S/C28H26FN3O4/c1-14-10-19(16(3)32-23-7-5-6-21(29)24(23)28(34)35)27-20(11-14)25(33)15(2)26(36-27)17-8-9-22(30)18(12-17)13-31-4/h5-13,16,32H,30H2,1-4H3,(H,34,35)/b31-13+/t16-/m1/s1 |
| InChIKey | STXIOKHRZMMLDM-NAXYESRQSA-N |
| XLogP | 5.72 |
| TPSA | 117.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|