C26H23F2N3O3 — CID 174166977
2-fluoro-6-[[(1R)-1-[2-(2-fluorophenyl)-3,6-dimethyl-4-oxochromen-8-yl]ethyl]amino]-N'-hydroxybenzenecarboximidamide (PubChem CID 174166977) has the molecular formula C26H23F2N3O3 and a molecular weight of 463.48 g/mol. Its IUPAC name is 2-fluoro-6-[[(1R)-1-[2-(2-fluorophenyl)-3,6-dimethyl-4-oxochromen-8-yl]ethyl]amino]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 2-fluoro-6-[[(1R)-1-[2-(2-fluorophenyl)-3,6-dimethyl-4-oxochromen-8-yl]ethyl]amino]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 174166977 |
| Molecular Formula | C26H23F2N3O3 |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 2-fluoro-6-[[(1R)-1-[2-(2-fluorophenyl)-3,6-dimethyl-4-oxochromen-8-yl]ethyl]amino]-N'-hydroxybenzenecarboximidamide |
| SMILES | Cc1cc([C@@H](C)Nc2cccc(F)c2C(N)=NO)c2oc(-c3ccccc3F)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C26H23F2N3O3/c1-13-11-17(15(3)30-21-10-6-9-20(28)22(21)26(29)31-33)25-18(12-13)23(32)14(2)24(34-25)16-7-4-5-8-19(16)27/h4-12,15,30,33H,1-3H3,(H2,29,31)/t15-/m1/s1 |
| InChIKey | AXALOFILJANJBU-OAHLLOKOSA-N |
| XLogP | 5.62 |
| TPSA | 100.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|