C27H28FN5O2 — CID 169268718
2-[1-[2-(2-fluorophenyl)-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-N'-hydrazinyl-5-methylbenzenecarboximidamide (PubChem CID 169268718) has the molecular formula C27H28FN5O2 and a molecular weight of 473.55 g/mol. Its IUPAC name is 2-[1-[2-(2-fluorophenyl)-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-N'-hydrazinyl-5-methylbenzenecarboximidamide.
| Compound Name | 2-[1-[2-(2-fluorophenyl)-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-N'-hydrazinyl-5-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 169268718 |
| Molecular Formula | C27H28FN5O2 |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 2-[1-[2-(2-fluorophenyl)-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-N'-hydrazinyl-5-methylbenzenecarboximidamide |
| SMILES | Cc1ccc(NC(C)c2cc(C)cc3c(=O)c(C)c(-c4ccccc4F)oc23)c(/C(N)=N/NN)c1 |
| InChI | InChI=1S/C27H28FN5O2/c1-14-9-10-23(20(11-14)27(29)32-33-30)31-17(4)19-12-15(2)13-21-24(34)16(3)25(35-26(19)21)18-7-5-6-8-22(18)28/h5-13,17,31,33H,30H2,1-4H3,(H2,29,32) |
| InChIKey | QJNNWSNIQJEFEY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 118.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|