C32H32F3N3O4 — CID 166147066
tert-butyl 2-[1-[2-[4-amino-3-(methyliminomethyl)phenyl]-6-methyl-4-oxo-3-(trifluoromethyl)chromen-8-yl]ethylamino]benzoate (PubChem CID 166147066) has the molecular formula C32H32F3N3O4 and a molecular weight of 579.62 g/mol. Its IUPAC name is tert-butyl 2-[1-[2-[4-amino-3-(methyliminomethyl)phenyl]-6-methyl-4-oxo-3-(trifluoromethyl)chromen-8-yl]ethylamino]benzoate.
| Compound Name | tert-butyl 2-[1-[2-[4-amino-3-(methyliminomethyl)phenyl]-6-methyl-4-oxo-3-(trifluoromethyl)chromen-8-yl]ethylamino]benzoate |
|---|---|
| PubChem CID | 166147066 |
| Molecular Formula | C32H32F3N3O4 |
| Molecular Weight | 579.62 g/mol |
| Exact Mass | 579.23 |
| IUPAC Name | tert-butyl 2-[1-[2-[4-amino-3-(methyliminomethyl)phenyl]-6-methyl-4-oxo-3-(trifluoromethyl)chromen-8-yl]ethylamino]benzoate |
| SMILES | C/N=C/c1cc(-c2oc3c(C(C)Nc4ccccc4C(=O)OC(C)(C)C)cc(C)cc3c(=O)c2C(F)(F)F)ccc1N |
| InChI | InChI=1S/C32H32F3N3O4/c1-17-13-22(18(2)38-25-10-8-7-9-21(25)30(40)42-31(3,4)5)29-23(14-17)27(39)26(32(33,34)35)28(41-29)19-11-12-24(36)20(15-19)16-37-6/h7-16,18,38H,36H2,1-6H3/b37-16+ |
| InChIKey | IIYRNWNDKRPCCV-YLYVUXRMSA-N |
| XLogP | 7.55 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.62 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|