C27H24ClN3O2 — CID 169269351
8-[1-[(6-chloro-2-methyl-3-pyridinyl)amino]ethyl]-2-(1H-indol-6-yl)-3,6-dimethylchromen-4-one (PubChem CID 169269351) has the molecular formula C27H24ClN3O2 and a molecular weight of 457.96 g/mol. Its IUPAC name is 8-[1-[(6-chloro-2-methyl-3-pyridinyl)amino]ethyl]-2-(1H-indol-6-yl)-3,6-dimethylchromen-4-one.
| Compound Name | 8-[1-[(6-chloro-2-methyl-3-pyridinyl)amino]ethyl]-2-(1H-indol-6-yl)-3,6-dimethylchromen-4-one |
|---|---|
| PubChem CID | 169269351 |
| Molecular Formula | C27H24ClN3O2 |
| Molecular Weight | 457.96 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 8-[1-[(6-chloro-2-methyl-3-pyridinyl)amino]ethyl]-2-(1H-indol-6-yl)-3,6-dimethylchromen-4-one |
| SMILES | Cc1cc(C(C)Nc2ccc(Cl)nc2C)c2oc(-c3ccc4cc[nH]c4c3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C27H24ClN3O2/c1-14-11-20(16(3)30-22-7-8-24(28)31-17(22)4)27-21(12-14)25(32)15(2)26(33-27)19-6-5-18-9-10-29-23(18)13-19/h5-13,16,29-30H,1-4H3 |
| InChIKey | JWZRBFRUTSVSIF-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.96 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|