C21H23ClN2O2S — CID 170339360
8-[1-[(6-chloro-2-methyl-3-pyridinyl)amino]ethyl]-2-ethylsulfanyl-3,6-dimethylchromen-4-one (PubChem CID 170339360) has the molecular formula C21H23ClN2O2S and a molecular weight of 402.95 g/mol. Its IUPAC name is 8-[1-[(6-chloro-2-methyl-3-pyridinyl)amino]ethyl]-2-ethylsulfanyl-3,6-dimethylchromen-4-one.
| Compound Name | 8-[1-[(6-chloro-2-methyl-3-pyridinyl)amino]ethyl]-2-ethylsulfanyl-3,6-dimethylchromen-4-one |
|---|---|
| PubChem CID | 170339360 |
| Molecular Formula | C21H23ClN2O2S |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 8-[1-[(6-chloro-2-methyl-3-pyridinyl)amino]ethyl]-2-ethylsulfanyl-3,6-dimethylchromen-4-one |
| SMILES | CCSc1oc2c(C(C)Nc3ccc(Cl)nc3C)cc(C)cc2c(=O)c1C |
| InChI | InChI=1S/C21H23ClN2O2S/c1-6-27-21-12(3)19(25)16-10-11(2)9-15(20(16)26-21)13(4)23-17-7-8-18(22)24-14(17)5/h7-10,13,23H,6H2,1-5H3 |
| InChIKey | VRKBIHKHGOEXHX-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|