C29H29ClN6O4 — CID 169270054
[[C-[6-chloro-3-[1-[2-[3-methanimidoyl-4-(methylamino)phenyl]-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-2-pyridinyl]-N-methylcarbonimidoyl]amino] formate (PubChem CID 169270054) has the molecular formula C29H29ClN6O4 and a molecular weight of 561.04 g/mol. Its IUPAC name is [[C-[6-chloro-3-[1-[2-[3-methanimidoyl-4-(methylamino)phenyl]-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-2-pyridinyl]-N-methylcarbonimidoyl]amino] formate.
| Compound Name | [[C-[6-chloro-3-[1-[2-[3-methanimidoyl-4-(methylamino)phenyl]-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-2-pyridinyl]-N-methylcarbonimidoyl]amino] formate |
|---|---|
| PubChem CID | 169270054 |
| Molecular Formula | C29H29ClN6O4 |
| Molecular Weight | 561.04 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | [[C-[6-chloro-3-[1-[2-[3-methanimidoyl-4-(methylamino)phenyl]-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-2-pyridinyl]-N-methylcarbonimidoyl]amino] formate |
| SMILES | [H]/N=C/c1cc(-c2oc3c(C(C)Nc4ccc(Cl)nc4/C(=N/C)NOC=O)cc(C)cc3c(=O)c2C)ccc1NC |
| InChI | InChI=1S/C29H29ClN6O4/c1-15-10-20(17(3)34-23-8-9-24(30)35-25(23)29(33-5)36-39-14-37)28-21(11-15)26(38)16(2)27(40-28)18-6-7-22(32-4)19(12-18)13-31/h6-14,17,31-32,34H,1-5H3,(H,33,36)/b31-13+ |
| InChIKey | LSYLKWZOQANJPA-IURWMYGYSA-N |
| XLogP | 5.39 |
| TPSA | 141.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.04 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|