C27H25ClN6O3 — CID 170671077
6-chloro-3-[[(1R)-1-[3,6-dimethyl-2-(1-methylindazol-5-yl)-4-oxochromen-8-yl]ethyl]amino]-N'-hydroxypyridine-2-carboximidamide (PubChem CID 170671077) has the molecular formula C27H25ClN6O3 and a molecular weight of 516.99 g/mol. Its IUPAC name is 6-chloro-3-[[(1R)-1-[3,6-dimethyl-2-(1-methylindazol-5-yl)-4-oxochromen-8-yl]ethyl]amino]-N'-hydroxypyridine-2-carboximidamide.
| Compound Name | 6-chloro-3-[[(1R)-1-[3,6-dimethyl-2-(1-methylindazol-5-yl)-4-oxochromen-8-yl]ethyl]amino]-N'-hydroxypyridine-2-carboximidamide |
|---|---|
| PubChem CID | 170671077 |
| Molecular Formula | C27H25ClN6O3 |
| Molecular Weight | 516.99 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | 6-chloro-3-[[(1R)-1-[3,6-dimethyl-2-(1-methylindazol-5-yl)-4-oxochromen-8-yl]ethyl]amino]-N'-hydroxypyridine-2-carboximidamide |
| SMILES | Cc1cc([C@@H](C)Nc2ccc(Cl)nc2/C(N)=N/O)c2oc(-c3ccc4c(cnn4C)c3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C27H25ClN6O3/c1-13-9-18(15(3)31-20-6-8-22(28)32-23(20)27(29)33-36)26-19(10-13)24(35)14(2)25(37-26)16-5-7-21-17(11-16)12-30-34(21)4/h5-12,15,31,36H,1-4H3,(H2,29,33)/t15-/m1/s1 |
| InChIKey | KKMRYIGARLJVHL-OAHLLOKOSA-N |
| XLogP | 5.28 |
| TPSA | 131.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.99 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|