C26H23ClN6O4 — CID 171549146
6-chloro-3-[(1R)-1-[3,6-dimethyl-2-(1-methylpyrazolo[5,4-b]pyridin-6-yl)-4-oxochromen-8-yl]ethoxy]-N'-hydroxypyridine-2-carboximidamide (PubChem CID 171549146) has the molecular formula C26H23ClN6O4 and a molecular weight of 518.96 g/mol. Its IUPAC name is 6-chloro-3-[(1R)-1-[3,6-dimethyl-2-(1-methylpyrazolo[5,4-b]pyridin-6-yl)-4-oxochromen-8-yl]ethoxy]-N'-hydroxypyridine-2-carboximidamide.
| Compound Name | 6-chloro-3-[(1R)-1-[3,6-dimethyl-2-(1-methylpyrazolo[5,4-b]pyridin-6-yl)-4-oxochromen-8-yl]ethoxy]-N'-hydroxypyridine-2-carboximidamide |
|---|---|
| PubChem CID | 171549146 |
| Molecular Formula | C26H23ClN6O4 |
| Molecular Weight | 518.96 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | 6-chloro-3-[(1R)-1-[3,6-dimethyl-2-(1-methylpyrazolo[5,4-b]pyridin-6-yl)-4-oxochromen-8-yl]ethoxy]-N'-hydroxypyridine-2-carboximidamide |
| SMILES | Cc1cc([C@@H](C)Oc2ccc(Cl)nc2/C(N)=N/O)c2oc(-c3ccc4cnn(C)c4n3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C26H23ClN6O4/c1-12-9-16(14(3)36-19-7-8-20(27)31-21(19)25(28)32-35)24-17(10-12)22(34)13(2)23(37-24)18-6-5-15-11-29-33(4)26(15)30-18/h5-11,14,35H,1-4H3,(H2,28,32)/t14-/m1/s1 |
| InChIKey | PDQGHTCSQHSPET-CQSZACIVSA-N |
| XLogP | 4.64 |
| TPSA | 141.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.96 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|