C24H19ClN2O5 — CID 171549075
6-chloro-3-[(1R)-1-(3,6-dimethyl-4-oxo-2-pyridin-2-ylchromen-8-yl)ethoxy]pyridine-2-carboxylic acid (PubChem CID 171549075) has the molecular formula C24H19ClN2O5 and a molecular weight of 450.88 g/mol. Its IUPAC name is 6-chloro-3-[(1R)-1-(3,6-dimethyl-4-oxo-2-pyridin-2-ylchromen-8-yl)ethoxy]pyridine-2-carboxylic acid.
| Compound Name | 6-chloro-3-[(1R)-1-(3,6-dimethyl-4-oxo-2-pyridin-2-ylchromen-8-yl)ethoxy]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 171549075 |
| Molecular Formula | C24H19ClN2O5 |
| Molecular Weight | 450.88 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 6-chloro-3-[(1R)-1-(3,6-dimethyl-4-oxo-2-pyridin-2-ylchromen-8-yl)ethoxy]pyridine-2-carboxylic acid |
| SMILES | Cc1cc([C@@H](C)Oc2ccc(Cl)nc2C(=O)O)c2oc(-c3ccccn3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C24H19ClN2O5/c1-12-10-15(14(3)31-18-7-8-19(25)27-20(18)24(29)30)23-16(11-12)21(28)13(2)22(32-23)17-6-4-5-9-26-17/h4-11,14H,1-3H3,(H,29,30)/t14-/m1/s1 |
| InChIKey | NZRUJBGZEIMFSH-CQSZACIVSA-N |
| XLogP | 5.36 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.88 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|