C26H20ClN3O5 — CID 171549018
6-chloro-3-[1-(2-furo[3,2-b]pyridin-6-yl-3,6-dimethyl-4-oxochromen-8-yl)ethoxy]pyridine-2-carboxamide (PubChem CID 171549018) has the molecular formula C26H20ClN3O5 and a molecular weight of 489.92 g/mol. Its IUPAC name is 6-chloro-3-[1-(2-furo[3,2-b]pyridin-6-yl-3,6-dimethyl-4-oxochromen-8-yl)ethoxy]pyridine-2-carboxamide.
| Compound Name | 6-chloro-3-[1-(2-furo[3,2-b]pyridin-6-yl-3,6-dimethyl-4-oxochromen-8-yl)ethoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 171549018 |
| Molecular Formula | C26H20ClN3O5 |
| Molecular Weight | 489.92 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | 6-chloro-3-[1-(2-furo[3,2-b]pyridin-6-yl-3,6-dimethyl-4-oxochromen-8-yl)ethoxy]pyridine-2-carboxamide |
| SMILES | Cc1cc(C(C)Oc2ccc(Cl)nc2C(N)=O)c2oc(-c3cnc4ccoc4c3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C26H20ClN3O5/c1-12-8-16(14(3)34-19-4-5-21(27)30-22(19)26(28)32)25-17(9-12)23(31)13(2)24(35-25)15-10-20-18(29-11-15)6-7-33-20/h4-11,14H,1-3H3,(H2,28,32) |
| InChIKey | SQKOMCDIFSOMNI-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 121.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.92 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|