C28H24ClN3O4S — CID 171548993
6-chloro-3-[(1R)-1-[2-(2-ethyl-1,3-benzothiazol-6-yl)-3,6-dimethyl-4-oxochromen-8-yl]ethoxy]pyridine-2-carboxamide (PubChem CID 171548993) has the molecular formula C28H24ClN3O4S and a molecular weight of 534.04 g/mol. Its IUPAC name is 6-chloro-3-[(1R)-1-[2-(2-ethyl-1,3-benzothiazol-6-yl)-3,6-dimethyl-4-oxochromen-8-yl]ethoxy]pyridine-2-carboxamide.
| Compound Name | 6-chloro-3-[(1R)-1-[2-(2-ethyl-1,3-benzothiazol-6-yl)-3,6-dimethyl-4-oxochromen-8-yl]ethoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 171548993 |
| Molecular Formula | C28H24ClN3O4S |
| Molecular Weight | 534.04 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | 6-chloro-3-[(1R)-1-[2-(2-ethyl-1,3-benzothiazol-6-yl)-3,6-dimethyl-4-oxochromen-8-yl]ethoxy]pyridine-2-carboxamide |
| SMILES | CCc1nc2ccc(-c3oc4c([C@@H](C)Oc5ccc(Cl)nc5C(N)=O)cc(C)cc4c(=O)c3C)cc2s1 |
| InChI | InChI=1S/C28H24ClN3O4S/c1-5-23-31-19-7-6-16(12-21(19)37-23)26-14(3)25(33)18-11-13(2)10-17(27(18)36-26)15(4)35-20-8-9-22(29)32-24(20)28(30)34/h6-12,15H,5H2,1-4H3,(H2,30,34)/t15-/m1/s1 |
| InChIKey | ANDRUPRCBKLDQH-OAHLLOKOSA-N |
| XLogP | 6.54 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.04 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|