C22H21ClN6O4 — CID 171611128
6-chloro-3-[(1R)-1-[3,6-dimethyl-2-(2-methyltriazol-4-yl)-4-oxochromen-8-yl]ethoxy]-N'-hydroxypyridine-2-carboximidamide (PubChem CID 171611128) has the molecular formula C22H21ClN6O4 and a molecular weight of 468.90 g/mol. Its IUPAC name is 6-chloro-3-[(1R)-1-[3,6-dimethyl-2-(2-methyltriazol-4-yl)-4-oxochromen-8-yl]ethoxy]-N'-hydroxypyridine-2-carboximidamide.
| Compound Name | 6-chloro-3-[(1R)-1-[3,6-dimethyl-2-(2-methyltriazol-4-yl)-4-oxochromen-8-yl]ethoxy]-N'-hydroxypyridine-2-carboximidamide |
|---|---|
| PubChem CID | 171611128 |
| Molecular Formula | C22H21ClN6O4 |
| Molecular Weight | 468.90 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 6-chloro-3-[(1R)-1-[3,6-dimethyl-2-(2-methyltriazol-4-yl)-4-oxochromen-8-yl]ethoxy]-N'-hydroxypyridine-2-carboximidamide |
| SMILES | Cc1cc([C@@H](C)Oc2ccc(Cl)nc2/C(N)=N/O)c2oc(-c3cnn(C)n3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C22H21ClN6O4/c1-10-7-13(12(3)32-16-5-6-17(23)26-18(16)22(24)28-31)21-14(8-10)19(30)11(2)20(33-21)15-9-25-29(4)27-15/h5-9,12,31H,1-4H3,(H2,24,28)/t12-/m1/s1 |
| InChIKey | JFLBNRPCCRAHSW-GFCCVEGCSA-N |
| XLogP | 3.49 |
| TPSA | 141.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.90 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|