C25H19ClN4O5 — CID 171611155
6-chloro-3-[(1R)-1-[3,6-dimethyl-2-([1,3]oxazolo[5,4-b]pyridin-6-yl)-4-oxochromen-8-yl]ethoxy]pyridine-2-carboxamide (PubChem CID 171611155) has the molecular formula C25H19ClN4O5 and a molecular weight of 490.90 g/mol. Its IUPAC name is 6-chloro-3-[(1R)-1-[3,6-dimethyl-2-([1,3]oxazolo[5,4-b]pyridin-6-yl)-4-oxochromen-8-yl]ethoxy]pyridine-2-carboxamide.
| Compound Name | 6-chloro-3-[(1R)-1-[3,6-dimethyl-2-([1,3]oxazolo[5,4-b]pyridin-6-yl)-4-oxochromen-8-yl]ethoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 171611155 |
| Molecular Formula | C25H19ClN4O5 |
| Molecular Weight | 490.90 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | 6-chloro-3-[(1R)-1-[3,6-dimethyl-2-([1,3]oxazolo[5,4-b]pyridin-6-yl)-4-oxochromen-8-yl]ethoxy]pyridine-2-carboxamide |
| SMILES | Cc1cc([C@@H](C)Oc2ccc(Cl)nc2C(N)=O)c2oc(-c3cnc4ocnc4c3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C25H19ClN4O5/c1-11-6-15(13(3)34-18-4-5-19(26)30-20(18)24(27)32)23-16(7-11)21(31)12(2)22(35-23)14-8-17-25(28-9-14)33-10-29-17/h4-10,13H,1-3H3,(H2,27,32)/t13-/m1/s1 |
| InChIKey | PJUAUOYQORRFBG-CYBMUJFWSA-N |
| XLogP | 4.90 |
| TPSA | 134.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.90 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|