C29H25ClN4O5 — CID 171549435
6-chloro-3-[(1R)-1-[3,6-dimethyl-2-[2-(oxetan-3-yl)indazol-5-yl]-4-oxochromen-8-yl]ethoxy]pyridine-2-carboxamide (PubChem CID 171549435) has the molecular formula C29H25ClN4O5 and a molecular weight of 545.00 g/mol. Its IUPAC name is 6-chloro-3-[(1R)-1-[3,6-dimethyl-2-[2-(oxetan-3-yl)indazol-5-yl]-4-oxochromen-8-yl]ethoxy]pyridine-2-carboxamide.
| Compound Name | 6-chloro-3-[(1R)-1-[3,6-dimethyl-2-[2-(oxetan-3-yl)indazol-5-yl]-4-oxochromen-8-yl]ethoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 171549435 |
| Molecular Formula | C29H25ClN4O5 |
| Molecular Weight | 545.00 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | 6-chloro-3-[(1R)-1-[3,6-dimethyl-2-[2-(oxetan-3-yl)indazol-5-yl]-4-oxochromen-8-yl]ethoxy]pyridine-2-carboxamide |
| SMILES | Cc1cc([C@@H](C)Oc2ccc(Cl)nc2C(N)=O)c2oc(-c3ccc4nn(C5COC5)cc4c3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C29H25ClN4O5/c1-14-8-20(16(3)38-23-6-7-24(30)32-25(23)29(31)36)28-21(9-14)26(35)15(2)27(39-28)17-4-5-22-18(10-17)11-34(33-22)19-12-37-13-19/h4-11,16,19H,12-13H2,1-3H3,(H2,31,36)/t16-/m1/s1 |
| InChIKey | PWXVVYQUUFKADD-MRXNPFEDSA-N |
| XLogP | 5.29 |
| TPSA | 122.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.00 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|