C27H25ClN4O6S — CID 171549398
6-chloro-3-[1-[2-[2-(2-hydroxyethyl)indazol-5-yl]-3,6-dimethyl-4-oxochromen-8-yl]ethoxy]pyridine-2-sulfonamide (PubChem CID 171549398) has the molecular formula C27H25ClN4O6S and a molecular weight of 569.04 g/mol. Its IUPAC name is 6-chloro-3-[1-[2-[2-(2-hydroxyethyl)indazol-5-yl]-3,6-dimethyl-4-oxochromen-8-yl]ethoxy]pyridine-2-sulfonamide.
| Compound Name | 6-chloro-3-[1-[2-[2-(2-hydroxyethyl)indazol-5-yl]-3,6-dimethyl-4-oxochromen-8-yl]ethoxy]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 171549398 |
| Molecular Formula | C27H25ClN4O6S |
| Molecular Weight | 569.04 g/mol |
| Exact Mass | 568.12 |
| IUPAC Name | 6-chloro-3-[1-[2-[2-(2-hydroxyethyl)indazol-5-yl]-3,6-dimethyl-4-oxochromen-8-yl]ethoxy]pyridine-2-sulfonamide |
| SMILES | Cc1cc(C(C)Oc2ccc(Cl)nc2S(N)(=O)=O)c2oc(-c3ccc4nn(CCO)cc4c3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C27H25ClN4O6S/c1-14-10-19(16(3)37-22-6-7-23(28)30-27(22)39(29,35)36)26-20(11-14)24(34)15(2)25(38-26)17-4-5-21-18(12-17)13-32(31-21)8-9-33/h4-7,10-13,16,33H,8-9H2,1-3H3,(H2,29,35,36) |
| InChIKey | QJLWYNODAOWZKM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.04 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|