C23H23ClN4O5S — CID 171549107
6-chloro-3-[(1R)-1-[2-(1,5-dimethylpyrazol-4-yl)-3,6-dimethyl-4-oxochromen-8-yl]ethoxy]pyridine-2-sulfonamide (PubChem CID 171549107) has the molecular formula C23H23ClN4O5S and a molecular weight of 502.98 g/mol. Its IUPAC name is 6-chloro-3-[(1R)-1-[2-(1,5-dimethylpyrazol-4-yl)-3,6-dimethyl-4-oxochromen-8-yl]ethoxy]pyridine-2-sulfonamide.
| Compound Name | 6-chloro-3-[(1R)-1-[2-(1,5-dimethylpyrazol-4-yl)-3,6-dimethyl-4-oxochromen-8-yl]ethoxy]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 171549107 |
| Molecular Formula | C23H23ClN4O5S |
| Molecular Weight | 502.98 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | 6-chloro-3-[(1R)-1-[2-(1,5-dimethylpyrazol-4-yl)-3,6-dimethyl-4-oxochromen-8-yl]ethoxy]pyridine-2-sulfonamide |
| SMILES | Cc1cc([C@@H](C)Oc2ccc(Cl)nc2S(N)(=O)=O)c2oc(-c3cnn(C)c3C)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C23H23ClN4O5S/c1-11-8-15(14(4)32-18-6-7-19(24)27-23(18)34(25,30)31)22-16(9-11)20(29)12(2)21(33-22)17-10-26-28(5)13(17)3/h6-10,14H,1-5H3,(H2,25,30,31)/t14-/m1/s1 |
| InChIKey | CLEITFBHCISZRM-CQSZACIVSA-N |
| XLogP | 3.95 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.98 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|