C22H19ClFN3O3 — CID 171611228
8-[(1R)-1-[(6-chloro-2-fluoro-3-pyridinyl)oxy]ethyl]-3,6-dimethyl-2-(1-methylpyrazol-4-yl)chromen-4-one (PubChem CID 171611228) has the molecular formula C22H19ClFN3O3 and a molecular weight of 427.86 g/mol. Its IUPAC name is 8-[(1R)-1-[(6-chloro-2-fluoro-3-pyridinyl)oxy]ethyl]-3,6-dimethyl-2-(1-methylpyrazol-4-yl)chromen-4-one.
| Compound Name | 8-[(1R)-1-[(6-chloro-2-fluoro-3-pyridinyl)oxy]ethyl]-3,6-dimethyl-2-(1-methylpyrazol-4-yl)chromen-4-one |
|---|---|
| PubChem CID | 171611228 |
| Molecular Formula | C22H19ClFN3O3 |
| Molecular Weight | 427.86 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 8-[(1R)-1-[(6-chloro-2-fluoro-3-pyridinyl)oxy]ethyl]-3,6-dimethyl-2-(1-methylpyrazol-4-yl)chromen-4-one |
| SMILES | Cc1cc([C@@H](C)Oc2ccc(Cl)nc2F)c2oc(-c3cnn(C)c3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C22H19ClFN3O3/c1-11-7-15(13(3)29-17-5-6-18(23)26-22(17)24)21-16(8-11)19(28)12(2)20(30-21)14-9-25-27(4)10-14/h5-10,13H,1-4H3/t13-/m1/s1 |
| InChIKey | CCDPQXCQBUDELA-CYBMUJFWSA-N |
| XLogP | 5.14 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.86 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|