C24H20ClN5O5S — CID 171611174
6-chloro-3-[(1R)-1-(2-imidazo[1,2-a]pyrimidin-6-yl-3,6-dimethyl-4-oxochromen-8-yl)ethoxy]pyridine-2-sulfonamide (PubChem CID 171611174) has the molecular formula C24H20ClN5O5S and a molecular weight of 525.97 g/mol. Its IUPAC name is 6-chloro-3-[(1R)-1-(2-imidazo[1,2-a]pyrimidin-6-yl-3,6-dimethyl-4-oxochromen-8-yl)ethoxy]pyridine-2-sulfonamide.
| Compound Name | 6-chloro-3-[(1R)-1-(2-imidazo[1,2-a]pyrimidin-6-yl-3,6-dimethyl-4-oxochromen-8-yl)ethoxy]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 171611174 |
| Molecular Formula | C24H20ClN5O5S |
| Molecular Weight | 525.97 g/mol |
| Exact Mass | 525.09 |
| IUPAC Name | 6-chloro-3-[(1R)-1-(2-imidazo[1,2-a]pyrimidin-6-yl-3,6-dimethyl-4-oxochromen-8-yl)ethoxy]pyridine-2-sulfonamide |
| SMILES | Cc1cc([C@@H](C)Oc2ccc(Cl)nc2S(N)(=O)=O)c2oc(-c3cnc4nccn4c3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C24H20ClN5O5S/c1-12-8-16(14(3)34-18-4-5-19(25)29-23(18)36(26,32)33)22-17(9-12)20(31)13(2)21(35-22)15-10-28-24-27-6-7-30(24)11-15/h4-11,14H,1-3H3,(H2,26,32,33)/t14-/m1/s1 |
| InChIKey | IKZSFIKZGLIUEX-CQSZACIVSA-N |
| XLogP | 3.96 |
| TPSA | 142.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.97 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|