C24H22N2O5S — CID 171549219
3-[(1R)-1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethoxy]pyridine-2-sulfonamide (PubChem CID 171549219) has the molecular formula C24H22N2O5S and a molecular weight of 450.52 g/mol. Its IUPAC name is 3-[(1R)-1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethoxy]pyridine-2-sulfonamide.
| Compound Name | 3-[(1R)-1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethoxy]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 171549219 |
| Molecular Formula | C24H22N2O5S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 3-[(1R)-1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethoxy]pyridine-2-sulfonamide |
| SMILES | Cc1cc([C@@H](C)Oc2cccnc2S(N)(=O)=O)c2oc(-c3ccccc3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C24H22N2O5S/c1-14-12-18(16(3)30-20-10-7-11-26-24(20)32(25,28)29)23-19(13-14)21(27)15(2)22(31-23)17-8-5-4-6-9-17/h4-13,16H,1-3H3,(H2,25,28,29)/t16-/m1/s1 |
| InChIKey | URJHZGXLHCCNGV-MRXNPFEDSA-N |
| XLogP | 4.26 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |